C22H26N2O6 — CID 58134124
benzyl 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 58134124) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is benzyl 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | benzyl 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 58134124 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | benzyl 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CC(C)[C@@H](N)C(=O)OCCOCn1c(C(=O)OCc2ccccc2)cc2occc21 |
| InChI | InChI=1S/C22H26N2O6/c1-15(2)20(23)22(26)29-11-10-27-14-24-17-8-9-28-19(17)12-18(24)21(25)30-13-16-6-4-3-5-7-16/h3-9,12,15,20H,10-11,13-14,23H2,1-2H3/t20-/m1/s1 |
| InChIKey | CHLNTYKSJOXFMT-HXUWFJFHSA-N |
| XLogP | 3.09 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|