C22H22N2O4 — CID 146247812
dibenzyl 1-propan-2-ylpyrazole-3,5-dicarboxylate (PubChem CID 146247812) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is dibenzyl 1-propan-2-ylpyrazole-3,5-dicarboxylate.
| Compound Name | dibenzyl 1-propan-2-ylpyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 146247812 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | dibenzyl 1-propan-2-ylpyrazole-3,5-dicarboxylate |
| SMILES | CC(C)n1nc(C(=O)OCc2ccccc2)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H22N2O4/c1-16(2)24-20(22(26)28-15-18-11-7-4-8-12-18)13-19(23-24)21(25)27-14-17-9-5-3-6-10-17/h3-13,16H,14-15H2,1-2H3 |
| InChIKey | NBMIMRMMWBAKLE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |