benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate

C19H18N2O3 — CID 170055458

IUPACbenzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate
SMILESCC(C)n1ncc2cc(C(=O)OCc3ccccc3)ccc2c1=O
InChIInChI=1S/C19H18N2O3/c1-13(2)21-18(22)17-9-8-15(10-16(17)11-20-21)19(23)24-12-14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3
InChIKeyRUVJQWZNOAUCML-UHFFFAOYSA-N
MW322.36 g/mol
LogP3.33
Rot. Bonds4

About benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate

benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate (PubChem CID 170055458) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate.

Molecular Properties

Compound Namebenzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate
PubChem CID170055458
Molecular FormulaC19H18N2O3
Molecular Weight322.36 g/mol
Exact Mass322.13
IUPAC Namebenzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate
SMILESCC(C)n1ncc2cc(C(=O)OCc3ccccc3)ccc2c1=O
InChIInChI=1S/C19H18N2O3/c1-13(2)21-18(22)17-9-8-15(10-16(17)11-20-21)19(23)24-12-14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3
InChIKeyRUVJQWZNOAUCML-UHFFFAOYSA-N
XLogP3.33
TPSA61.19 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.36
LogP ≤ 53.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate?
The IUPAC name of benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate (CID 170055458) is benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate.
What is the SMILES notation for benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate?
The canonical SMILES for benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate is CC(C)n1ncc2cc(C(=O)OCc3ccccc3)ccc2c1=O.
What is the InChIKey of benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate?
The InChIKey is RUVJQWZNOAUCML-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-13(2)21-18(22)17-9-8-15(10-16(17)11-20-21)19(23)24-12-14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3.
What are the key properties of benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate?
benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate has a molecular weight of 322.36 g/mol, XLogP of 3.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 1-oxo-2-propan-2-ylphthalazine-6-carboxylate is sourced from PubChem (CID 170055458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).