About benzyl 1-bromoimidazole-4-carboxylate;hydrochloride
benzyl 1-bromoimidazole-4-carboxylate;hydrochloride (PubChem CID 174764433) has the molecular formula C11H10BrClN2O2
and a molecular weight of 317.57 g/mol. Its IUPAC name is benzyl 1-bromoimidazole-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | benzyl 1-bromoimidazole-4-carboxylate;hydrochloride |
| PubChem CID | 174764433 |
| Molecular Formula | C11H10BrClN2O2 |
| Molecular Weight | 317.57 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | benzyl 1-bromoimidazole-4-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCc1ccccc1)c1cn(Br)cn1 |
| InChI | InChI=1S/C11H9BrN2O2.ClH/c12-14-6-10(13-8-14)11(15)16-7-9-4-2-1-3-5-9;/h1-6,8H,7H2;1H |
| InChIKey | IAZGXXMJHCAXCI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 1-bromoimidazole-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 1-bromoimidazole-4-carboxylate;hydrochloride?
The IUPAC name of benzyl 1-bromoimidazole-4-carboxylate;hydrochloride (CID 174764433) is benzyl 1-bromoimidazole-4-carboxylate;hydrochloride.
What is the SMILES notation for benzyl 1-bromoimidazole-4-carboxylate;hydrochloride?
The canonical SMILES for benzyl 1-bromoimidazole-4-carboxylate;hydrochloride is Cl.O=C(OCc1ccccc1)c1cn(Br)cn1.
What is the InChIKey of benzyl 1-bromoimidazole-4-carboxylate;hydrochloride?
The InChIKey is IAZGXXMJHCAXCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrN2O2.ClH/c12-14-6-10(13-8-14)11(15)16-7-9-4-2-1-3-5-9;/h1-6,8H,7H2;1H.
What are the key properties of benzyl 1-bromoimidazole-4-carboxylate;hydrochloride?
benzyl 1-bromoimidazole-4-carboxylate;hydrochloride has a molecular weight of 317.57 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 1-bromoimidazole-4-carboxylate;hydrochloride is sourced from PubChem (CID 174764433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).