About ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate
ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate (PubChem CID 90181101) has the molecular formula C19H26BrF2NO4Si
and a molecular weight of 478.41 g/mol. Its IUPAC name is ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate |
| PubChem CID | 90181101 |
| Molecular Formula | C19H26BrF2NO4Si |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(OCC(F)F)c(Br)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H26BrF2NO4Si/c1-5-26-19(24)16-10-13-15(23(16)12-25-8-9-28(2,3)4)7-6-14(20)18(13)27-11-17(21)22/h6-7,10,17H,5,8-9,11-12H2,1-4H3 |
| InChIKey | HSBABVPZLGORJP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate?
The IUPAC name of ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate (CID 90181101) is ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate.
What is the SMILES notation for ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate?
The canonical SMILES for ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate is CCOC(=O)c1cc2c(OCC(F)F)c(Br)ccc2n1COCC[Si](C)(C)C.
What is the InChIKey of ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate?
The InChIKey is HSBABVPZLGORJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26BrF2NO4Si/c1-5-26-19(24)16-10-13-15(23(16)12-25-8-9-28(2,3)4)7-6-14(20)18(13)27-11-17(21)22/h6-7,10,17H,5,8-9,11-12H2,1-4H3.
What are the key properties of ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate?
ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate has a molecular weight of 478.41 g/mol, XLogP of 5.54, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate is sourced from PubChem (CID 90181101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).