C19H26BrF2NO4Si — CID 90181101
ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate (PubChem CID 90181101) has the molecular formula C19H26BrF2NO4Si and a molecular weight of 478.41 g/mol. Its IUPAC name is ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate.
| Compound Name | ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 90181101 |
| Molecular Formula | C19H26BrF2NO4Si |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | ethyl 5-bromo-4-(2,2-difluoroethoxy)-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(OCC(F)F)c(Br)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H26BrF2NO4Si/c1-5-26-19(24)16-10-13-15(23(16)12-25-8-9-28(2,3)4)7-6-14(20)18(13)27-11-17(21)22/h6-7,10,17H,5,8-9,11-12H2,1-4H3 |
| InChIKey | HSBABVPZLGORJP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|