C20H26N2O3Si — CID 10809190
ethyl 9-(2-trimethylsilylethoxymethyl)pyrido[3,4-b]indole-4-carboxylate (PubChem CID 10809190) has the molecular formula C20H26N2O3Si and a molecular weight of 370.53 g/mol. Its IUPAC name is ethyl 9-(2-trimethylsilylethoxymethyl)pyrido[3,4-b]indole-4-carboxylate.
| Compound Name | ethyl 9-(2-trimethylsilylethoxymethyl)pyrido[3,4-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 10809190 |
| Molecular Formula | C20H26N2O3Si |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | ethyl 9-(2-trimethylsilylethoxymethyl)pyrido[3,4-b]indole-4-carboxylate |
| SMILES | CCOC(=O)c1cncc2c1c1ccccc1n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H26N2O3Si/c1-5-25-20(23)16-12-21-13-18-19(16)15-8-6-7-9-17(15)22(18)14-24-10-11-26(2,3)4/h6-9,12-13H,5,10-11,14H2,1-4H3 |
| InChIKey | LVFHVYNNTWGQRC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|