C23H25ClN2OSi — CID 10621459
2-[[4-(4-chlorophenyl)pyrido[3,4-b]indol-9-yl]methoxy]ethyl-trimethylsilane (PubChem CID 10621459) has the molecular formula C23H25ClN2OSi and a molecular weight of 409.01 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)pyrido[3,4-b]indol-9-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(4-chlorophenyl)pyrido[3,4-b]indol-9-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 10621459 |
| Molecular Formula | C23H25ClN2OSi |
| Molecular Weight | 409.01 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)pyrido[3,4-b]indol-9-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c2ccccc2c2c(-c3ccc(Cl)cc3)cncc21 |
| InChI | InChI=1S/C23H25ClN2OSi/c1-28(2,3)13-12-27-16-26-21-7-5-4-6-19(21)23-20(14-25-15-22(23)26)17-8-10-18(24)11-9-17/h4-11,14-15H,12-13,16H2,1-3H3 |
| InChIKey | PCNKSRJBUWXLKN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.01 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|