C26H26ClNOSi — CID 71497150
2-[(10-chloro-21-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,15,17,19-decaen-21-yl)methoxy]ethyl-trimethylsilane (PubChem CID 71497150) has the molecular formula C26H26ClNOSi and a molecular weight of 432.04 g/mol. Its IUPAC name is 2-[(10-chloro-21-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,15,17,19-decaen-21-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(10-chloro-21-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,15,17,19-decaen-21-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 71497150 |
| Molecular Formula | C26H26ClNOSi |
| Molecular Weight | 432.04 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[(10-chloro-21-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,15,17,19-decaen-21-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c2ccccc2c2c3ccc(Cl)cc3c3ccccc3c21 |
| InChI | InChI=1S/C26H26ClNOSi/c1-30(2,3)15-14-29-17-28-24-11-7-6-10-22(24)25-20-13-12-18(27)16-23(20)19-8-4-5-9-21(19)26(25)28/h4-13,16H,14-15,17H2,1-3H3 |
| InChIKey | AOJAERRHNMCHAO-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.04 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|