About 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane
2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane (PubChem CID 164812062) has the molecular formula C17H21ClN2OSi
and a molecular weight of 332.91 g/mol. Its IUPAC name is 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane |
| PubChem CID | 164812062 |
| Molecular Formula | C17H21ClN2OSi |
| Molecular Weight | 332.91 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c2ccccc2c2ccc(Cl)nc21 |
| InChI | InChI=1S/C17H21ClN2OSi/c1-22(2,3)11-10-21-12-20-15-7-5-4-6-13(15)14-8-9-16(18)19-17(14)20/h4-9H,10-12H2,1-3H3 |
| InChIKey | LRRSMCABEWEDNS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.91 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane?
The IUPAC name of 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane (CID 164812062) is 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane.
What is the SMILES notation for 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane?
The canonical SMILES for 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane is C[Si](C)(C)CCOCn1c2ccccc2c2ccc(Cl)nc21.
What is the InChIKey of 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane?
The InChIKey is LRRSMCABEWEDNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN2OSi/c1-22(2,3)11-10-21-12-20-15-7-5-4-6-13(15)14-8-9-16(18)19-17(14)20/h4-9H,10-12H2,1-3H3.
What are the key properties of 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane?
2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane has a molecular weight of 332.91 g/mol, XLogP of 5.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloropyrido[2,3-b]indol-9-yl)methoxy]ethyl-trimethylsilane is sourced from PubChem (CID 164812062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).