C16H27NO2Si2 — CID 24807131
hydroxy-dimethyl-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]silane (PubChem CID 24807131) has the molecular formula C16H27NO2Si2 and a molecular weight of 321.57 g/mol. Its IUPAC name is hydroxy-dimethyl-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]silane.
| Compound Name | hydroxy-dimethyl-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]silane |
|---|---|
| PubChem CID | 24807131 |
| Molecular Formula | C16H27NO2Si2 |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | hydroxy-dimethyl-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]silane |
| SMILES | C[Si](C)(C)CCOCn1c([Si](C)(C)O)cc2ccccc21 |
| InChI | InChI=1S/C16H27NO2Si2/c1-20(2,3)11-10-19-13-17-15-9-7-6-8-14(15)12-16(17)21(4,5)18/h6-9,12,18H,10-11,13H2,1-5H3 |
| InChIKey | BGHWRLQBYVBXGO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|