C19H25N3O2Si — CID 154287838
N-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyaniline (PubChem CID 154287838) has the molecular formula C19H25N3O2Si and a molecular weight of 355.51 g/mol. Its IUPAC name is N-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyaniline.
| Compound Name | N-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyaniline |
|---|---|
| PubChem CID | 154287838 |
| Molecular Formula | C19H25N3O2Si |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyaniline |
| SMILES | C[Si](C)(C)CCOCn1c(ONc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C19H25N3O2Si/c1-25(2,3)14-13-23-15-22-18-12-8-7-11-17(18)20-19(22)24-21-16-9-5-4-6-10-16/h4-12,21H,13-15H2,1-3H3 |
| InChIKey | ZEANTEUJIPMLMD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|