C27H33N5O3Si — CID 67127993
1-ethyl-3-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]-3a,4-dihydroimidazo[4,5-b]pyridin-2-one (PubChem CID 67127993) has the molecular formula C27H33N5O3Si and a molecular weight of 503.68 g/mol. Its IUPAC name is 1-ethyl-3-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]-3a,4-dihydroimidazo[4,5-b]pyridin-2-one.
| Compound Name | 1-ethyl-3-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]-3a,4-dihydroimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 67127993 |
| Molecular Formula | C27H33N5O3Si |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 1-ethyl-3-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]-3a,4-dihydroimidazo[4,5-b]pyridin-2-one |
| SMILES | CCN1C(=O)N(c2ccc(Oc3nc4ccccc4n3COCC[Si](C)(C)C)cc2)C2NC=CC=C21 |
| InChI | InChI=1S/C27H33N5O3Si/c1-5-30-24-11-8-16-28-25(24)32(27(30)33)20-12-14-21(15-13-20)35-26-29-22-9-6-7-10-23(22)31(26)19-34-17-18-36(2,3)4/h6-16,25,28H,5,17-19H2,1-4H3 |
| InChIKey | XHGMVQTZYAALHU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|