C28H41N3O2Si — CID 69148848
N-(cyclopropylmethyl)-N-[2-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]ethyl]propan-1-amine (PubChem CID 69148848) has the molecular formula C28H41N3O2Si and a molecular weight of 479.74 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[2-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]ethyl]propan-1-amine.
| Compound Name | N-(cyclopropylmethyl)-N-[2-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 69148848 |
| Molecular Formula | C28H41N3O2Si |
| Molecular Weight | 479.74 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[2-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]ethyl]propan-1-amine |
| SMILES | CCCN(CCc1ccc(Oc2nc3ccccc3n2COCC[Si](C)(C)C)cc1)CC1CC1 |
| InChI | InChI=1S/C28H41N3O2Si/c1-5-17-30(21-24-10-11-24)18-16-23-12-14-25(15-13-23)33-28-29-26-8-6-7-9-27(26)31(28)22-32-19-20-34(2,3)4/h6-9,12-15,24H,5,10-11,16-22H2,1-4H3 |
| InChIKey | LUKSQCCFCHCLAI-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.74 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|