C24H37N3O4Si — CID 70104650
tert-butyl 4-[1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperidine-1-carboxylate (PubChem CID 70104650) has the molecular formula C24H37N3O4Si and a molecular weight of 459.66 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70104650 |
| Molecular Formula | C24H37N3O4Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | tert-butyl 4-[1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)c2nc3ccccc3n2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C24H37N3O4Si/c1-24(2,3)31-23(29)26-13-11-18(12-14-26)21(28)22-25-19-9-7-8-10-20(19)27(22)17-30-15-16-32(4,5)6/h7-10,18H,11-17H2,1-6H3 |
| InChIKey | WLCBCEYWYJDPKX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|