C31H39ClN6O4Si — CID 153454008
tert-butyl 4-[5-(4-chloro-1,6-naphthyridin-2-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperazine-1-carboxylate (PubChem CID 153454008) has the molecular formula C31H39ClN6O4Si and a molecular weight of 623.23 g/mol. Its IUPAC name is tert-butyl 4-[5-(4-chloro-1,6-naphthyridin-2-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(4-chloro-1,6-naphthyridin-2-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 153454008 |
| Molecular Formula | C31H39ClN6O4Si |
| Molecular Weight | 623.23 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | tert-butyl 4-[5-(4-chloro-1,6-naphthyridin-2-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2nc3cc(-c4cc(Cl)c5cnccc5n4)ccc3n2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C31H39ClN6O4Si/c1-31(2,3)42-30(40)37-13-11-36(12-14-37)29(39)28-35-26-17-21(25-18-23(32)22-19-33-10-9-24(22)34-25)7-8-27(26)38(28)20-41-15-16-43(4,5)6/h7-10,17-19H,11-16,20H2,1-6H3 |
| InChIKey | AZLSABHTQRZUDK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 102.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.23 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|