C37H48N8O2Si — CID 153453993
N-[2-(dimethylamino)ethyl]-5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide (PubChem CID 153453993) has the molecular formula C37H48N8O2Si and a molecular weight of 664.93 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 153453993 |
| Molecular Formula | C37H48N8O2Si |
| Molecular Weight | 664.93 g/mol |
| Exact Mass | 664.37 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide |
| SMILES | CN(C)CCNC(=O)c1nc2cc(-c3cc(Nc4ccc(CN5CCCC5)cc4)c4cnccc4n3)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C37H48N8O2Si/c1-43(2)19-16-39-37(46)36-42-34-22-28(10-13-35(34)45(36)26-47-20-21-48(3,4)5)32-23-33(30-24-38-15-14-31(30)41-32)40-29-11-8-27(9-12-29)25-44-17-6-7-18-44/h8-15,22-24H,6-7,16-21,25-26H2,1-5H3,(H,39,46)(H,40,41) |
| InChIKey | FQJRIJKIRLMACF-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.93 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|