C30H34N6O — CID 135372873
4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-N-(2-pyridin-4-ylethyl)benzamide (PubChem CID 135372873) has the molecular formula C30H34N6O and a molecular weight of 494.64 g/mol. Its IUPAC name is 4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-N-(2-pyridin-4-ylethyl)benzamide.
| Compound Name | 4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-N-(2-pyridin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 135372873 |
| Molecular Formula | C30H34N6O |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-N-(2-pyridin-4-ylethyl)benzamide |
| SMILES | O=C(NCCc1ccncc1)c1ccc(-c2cc(NCCCN3CCCCC3)c3cnccc3n2)cc1 |
| InChI | InChI=1S/C30H34N6O/c37-30(34-17-11-23-9-14-31-15-10-23)25-7-5-24(6-8-25)28-21-29(26-22-32-16-12-27(26)35-28)33-13-4-20-36-18-2-1-3-19-36/h5-10,12,14-16,21-22H,1-4,11,13,17-20H2,(H,33,35)(H,34,37) |
| InChIKey | VPERPWKDWFVYFG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|