C24H29N5O2 — CID 135373155
N-methoxy-4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzamide (PubChem CID 135373155) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-methoxy-4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzamide.
| Compound Name | N-methoxy-4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 135373155 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-methoxy-4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzamide |
| SMILES | CONC(=O)c1ccc(-c2cc(NCCCN3CCCCC3)c3cnccc3n2)cc1 |
| InChI | InChI=1S/C24H29N5O2/c1-31-28-24(30)19-8-6-18(7-9-19)22-16-23(20-17-25-12-10-21(20)27-22)26-11-5-15-29-13-3-2-4-14-29/h6-10,12,16-17H,2-5,11,13-15H2,1H3,(H,26,27)(H,28,30) |
| InChIKey | YEQCOWFFJVORMH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|