C31H40N6O2 — CID 135372300
(E)-N-[2-(diethylamino)-2-oxoethyl]-3-[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide (PubChem CID 135372300) has the molecular formula C31H40N6O2 and a molecular weight of 528.70 g/mol. Its IUPAC name is (E)-N-[2-(diethylamino)-2-oxoethyl]-3-[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(diethylamino)-2-oxoethyl]-3-[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135372300 |
| Molecular Formula | C31H40N6O2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | (E)-N-[2-(diethylamino)-2-oxoethyl]-3-[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide |
| SMILES | CCN(CC)C(=O)CNC(=O)/C=C/c1ccc(-c2cc(NCCCN3CCCCC3)c3cnccc3n2)cc1 |
| InChI | InChI=1S/C31H40N6O2/c1-3-37(4-2)31(39)23-34-30(38)14-11-24-9-12-25(13-10-24)28-21-29(26-22-32-17-15-27(26)35-28)33-16-8-20-36-18-6-5-7-19-36/h9-15,17,21-22H,3-8,16,18-20,23H2,1-2H3,(H,33,35)(H,34,38)/b14-11+ |
| InChIKey | REUNDZGNRWXYBY-SDNWHVSQSA-N |
| XLogP | 4.58 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|