C28H35FN6O2S — CID 142467355
[2-formyl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]indol-1-yl] thiohypofluorite;methanol;N-methylmethanimine (PubChem CID 142467355) has the molecular formula C28H35FN6O2S and a molecular weight of 538.69 g/mol. Its IUPAC name is [2-formyl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]indol-1-yl] thiohypofluorite;methanol;N-methylmethanimine.
| Compound Name | [2-formyl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]indol-1-yl] thiohypofluorite;methanol;N-methylmethanimine |
|---|---|
| PubChem CID | 142467355 |
| Molecular Formula | C28H35FN6O2S |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | [2-formyl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]indol-1-yl] thiohypofluorite;methanol;N-methylmethanimine |
| SMILES | C=NC.CO.O=Cc1cc2ccc(-c3cc(NCCCN4CCCCC4)c4cnccc4n3)cc2n1SF |
| InChI | InChI=1S/C25H26FN5OS.C2H5N.CH4O/c26-33-31-20(17-32)13-19-6-5-18(14-25(19)31)23-15-24(21-16-27-9-7-22(21)29-23)28-8-4-12-30-10-2-1-3-11-30;1-3-2;1-2/h5-7,9,13-17H,1-4,8,10-12H2,(H,28,29);1H2,2H3;2H,1H3 |
| InChIKey | IKLGFHRSDSWHPS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|