C37H48N8O2Si — CID 153453981
5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-N-(2-pyridin-4-ylethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide (PubChem CID 153453981) has the molecular formula C37H48N8O2Si and a molecular weight of 664.93 g/mol. Its IUPAC name is 5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-N-(2-pyridin-4-ylethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide.
| Compound Name | 5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-N-(2-pyridin-4-ylethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 153453981 |
| Molecular Formula | C37H48N8O2Si |
| Molecular Weight | 664.93 g/mol |
| Exact Mass | 664.37 |
| IUPAC Name | 5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-N-(2-pyridin-4-ylethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1c(C(=O)NCCc2ccncc2)nc2cc(-c3cc(NCCCN4CCCCC4)c4cnccc4n3)ccc21 |
| InChI | InChI=1S/C37H48N8O2Si/c1-48(2,3)23-22-47-27-45-35-9-8-29(24-34(35)43-36(45)37(46)41-18-12-28-10-15-38-16-11-28)32-25-33(30-26-39-17-13-31(30)42-32)40-14-7-21-44-19-5-4-6-20-44/h8-11,13,15-17,24-26H,4-7,12,14,18-23,27H2,1-3H3,(H,40,42)(H,41,46) |
| InChIKey | LYWQXRNBVREQOX-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.93 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|