C27H36N6O — CID 135372997
N,N-diethyl-4-[4-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]benzamide (PubChem CID 135372997) has the molecular formula C27H36N6O and a molecular weight of 460.63 g/mol. Its IUPAC name is N,N-diethyl-4-[4-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]benzamide.
| Compound Name | N,N-diethyl-4-[4-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 135372997 |
| Molecular Formula | C27H36N6O |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | N,N-diethyl-4-[4-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(-c2cc(NCCCN3CCN(C)CC3)c3cnccc3n2)cc1 |
| InChI | InChI=1S/C27H36N6O/c1-4-33(5-2)27(34)22-9-7-21(8-10-22)25-19-26(23-20-28-13-11-24(23)30-25)29-12-6-14-32-17-15-31(3)16-18-32/h7-11,13,19-20H,4-6,12,14-18H2,1-3H3,(H,29,30) |
| InChIKey | CUCMIHUPENDULQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|