C28H31N5O2 — CID 135372770
N,N-diethyl-4-[4-[4-(2-methoxyethylamino)anilino]-1,6-naphthyridin-2-yl]benzamide (PubChem CID 135372770) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N,N-diethyl-4-[4-[4-(2-methoxyethylamino)anilino]-1,6-naphthyridin-2-yl]benzamide.
| Compound Name | N,N-diethyl-4-[4-[4-(2-methoxyethylamino)anilino]-1,6-naphthyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 135372770 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N,N-diethyl-4-[4-[4-(2-methoxyethylamino)anilino]-1,6-naphthyridin-2-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(-c2cc(Nc3ccc(NCCOC)cc3)c3cnccc3n2)cc1 |
| InChI | InChI=1S/C28H31N5O2/c1-4-33(5-2)28(34)21-8-6-20(7-9-21)26-18-27(24-19-29-15-14-25(24)32-26)31-23-12-10-22(11-13-23)30-16-17-35-3/h6-15,18-19,30H,4-5,16-17H2,1-3H3,(H,31,32) |
| InChIKey | WQEKLCFSDKCBPE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|