C23H30N4O4 — CID 54833883
3-[[2-[4-(diethylcarbamoyl)anilino]acetyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 54833883) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-[[2-[4-(diethylcarbamoyl)anilino]acetyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[[2-[4-(diethylcarbamoyl)anilino]acetyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 54833883 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 3-[[2-[4-(diethylcarbamoyl)anilino]acetyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NCC(=O)Nc2cccc(C(=O)NCCOC)c2)cc1 |
| InChI | InChI=1S/C23H30N4O4/c1-4-27(5-2)23(30)17-9-11-19(12-10-17)25-16-21(28)26-20-8-6-7-18(15-20)22(29)24-13-14-31-3/h6-12,15,25H,4-5,13-14,16H2,1-3H3,(H,24,29)(H,26,28) |
| InChIKey | OAAQBZIKOCQRKI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|