C22H28N4O4 — CID 54838931
N-(2-methoxyethyl)-3-[[2-[4-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54838931) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[[2-[4-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-(2-methoxyethyl)-3-[[2-[4-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54838931 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-(2-methoxyethyl)-3-[[2-[4-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CCC(=O)Nc1cc(NC(=O)CNc2cccc(C(=O)NCCOC)c2)ccc1C |
| InChI | InChI=1S/C22H28N4O4/c1-4-20(27)26-19-13-18(9-8-15(19)2)25-21(28)14-24-17-7-5-6-16(12-17)22(29)23-10-11-30-3/h5-9,12-13,24H,4,10-11,14H2,1-3H3,(H,23,29)(H,25,28)(H,26,27) |
| InChIKey | KEYJGOXWHPKATI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|