C23H30N4O4 — CID 54842675
N-(3-methoxypropyl)-3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54842675) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-(3-methoxypropyl)-3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-(3-methoxypropyl)-3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54842675 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-(3-methoxypropyl)-3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)CNc2cccc(C(=O)NCCCOC)c2)c1C |
| InChI | InChI=1S/C23H30N4O4/c1-4-21(28)26-19-10-6-11-20(16(19)2)27-22(29)15-25-18-9-5-8-17(14-18)23(30)24-12-7-13-31-3/h5-6,8-11,14,25H,4,7,12-13,15H2,1-3H3,(H,24,30)(H,26,28)(H,27,29) |
| InChIKey | RRTAYPVRJXHEAQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|