C24H30N4O4 — CID 54836486
4-[[2-[3-(cyclopropanecarbonylamino)-2-methylanilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide (PubChem CID 54836486) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-[[2-[3-(cyclopropanecarbonylamino)-2-methylanilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-[[2-[3-(cyclopropanecarbonylamino)-2-methylanilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 54836486 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 4-[[2-[3-(cyclopropanecarbonylamino)-2-methylanilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1ccc(NCC(=O)Nc2cccc(NC(=O)C3CC3)c2C)cc1 |
| InChI | InChI=1S/C24H30N4O4/c1-16-20(5-3-6-21(16)28-24(31)18-7-8-18)27-22(29)15-26-19-11-9-17(10-12-19)23(30)25-13-4-14-32-2/h3,5-6,9-12,18,26H,4,7-8,13-15H2,1-2H3,(H,25,30)(H,27,29)(H,28,31) |
| InChIKey | SFEIEQDFUAPHPW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|