C20H25N3O4 — CID 54835567
4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide (PubChem CID 54835567) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 54835567 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1ccc(NCC(=O)Nc2ccccc2OC)cc1 |
| InChI | InChI=1S/C20H25N3O4/c1-26-13-5-12-21-20(25)15-8-10-16(11-9-15)22-14-19(24)23-17-6-3-4-7-18(17)27-2/h3-4,6-11,22H,5,12-14H2,1-2H3,(H,21,25)(H,23,24) |
| InChIKey | PCGLNGNVGGXTHI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|