C16H15N2O4- — CID 2329031
4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]benzoate (PubChem CID 2329031) has the molecular formula C16H15N2O4- and a molecular weight of 299.31 g/mol. Its IUPAC name is 4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | 4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 2329031 |
| Molecular Formula | C16H15N2O4- |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]benzoate |
| SMILES | COc1ccccc1NC(=O)CNc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H16N2O4/c1-22-14-5-3-2-4-13(14)18-15(19)10-17-12-8-6-11(7-9-12)16(20)21/h2-9,17H,10H2,1H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | CXAMVWZDVNZJLC-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |