C25H34N4O4 — CID 54835986
3-[[2-[4-(2-methoxyethylcarbamoyl)anilino]acetyl]amino]-N,N-dipropylbenzamide (PubChem CID 54835986) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-[[2-[4-(2-methoxyethylcarbamoyl)anilino]acetyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 3-[[2-[4-(2-methoxyethylcarbamoyl)anilino]acetyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 54835986 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 3-[[2-[4-(2-methoxyethylcarbamoyl)anilino]acetyl]amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(NC(=O)CNc2ccc(C(=O)NCCOC)cc2)c1 |
| InChI | InChI=1S/C25H34N4O4/c1-4-14-29(15-5-2)25(32)20-7-6-8-22(17-20)28-23(30)18-27-21-11-9-19(10-12-21)24(31)26-13-16-33-3/h6-12,17,27H,4-5,13-16,18H2,1-3H3,(H,26,31)(H,28,30) |
| InChIKey | CCNCBIAKLYLZRE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|