C29H34N4O3 — CID 54842373
N-[4-[[2-[3-(dipropylcarbamoyl)anilino]-2-oxoethyl]amino]phenyl]-3-methylbenzamide (PubChem CID 54842373) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-[4-[[2-[3-(dipropylcarbamoyl)anilino]-2-oxoethyl]amino]phenyl]-3-methylbenzamide.
| Compound Name | N-[4-[[2-[3-(dipropylcarbamoyl)anilino]-2-oxoethyl]amino]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 54842373 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | N-[4-[[2-[3-(dipropylcarbamoyl)anilino]-2-oxoethyl]amino]phenyl]-3-methylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(NC(=O)CNc2ccc(NC(=O)c3cccc(C)c3)cc2)c1 |
| InChI | InChI=1S/C29H34N4O3/c1-4-16-33(17-5-2)29(36)23-10-7-11-26(19-23)31-27(34)20-30-24-12-14-25(15-13-24)32-28(35)22-9-6-8-21(3)18-22/h6-15,18-19,30H,4-5,16-17,20H2,1-3H3,(H,31,34)(H,32,35) |
| InChIKey | JSXBSFUHGCOFAK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |