C18H29N3O3 — CID 54831987
4-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]-N,N-dipropylbenzamide (PubChem CID 54831987) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 4-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 54831987 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 4-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(NCC(=O)NCCOC)cc1 |
| InChI | InChI=1S/C18H29N3O3/c1-4-11-21(12-5-2)18(23)15-6-8-16(9-7-15)20-14-17(22)19-10-13-24-3/h6-9,20H,4-5,10-14H2,1-3H3,(H,19,22) |
| InChIKey | ONSQTZIPHSYCNN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|