C34H38N6O — CID 142467277
(E)-N-(1-methylpiperidin-4-yl)-3-[4-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide (PubChem CID 142467277) has the molecular formula C34H38N6O and a molecular weight of 546.72 g/mol. Its IUPAC name is (E)-N-(1-methylpiperidin-4-yl)-3-[4-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1-methylpiperidin-4-yl)-3-[4-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 142467277 |
| Molecular Formula | C34H38N6O |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | (E)-N-(1-methylpiperidin-4-yl)-3-[4-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide |
| SMILES | CN1CCC(NC(=O)/C=C/c2ccc(-c3cc(Nc4ccc(CN5CCCC5)cc4)c4cnccc4n3)cc2)CC1 |
| InChI | InChI=1S/C34H38N6O/c1-39-20-15-29(16-21-39)37-34(41)13-8-25-4-9-27(10-5-25)32-22-33(30-23-35-17-14-31(30)38-32)36-28-11-6-26(7-12-28)24-40-18-2-3-19-40/h4-14,17,22-23,29H,2-3,15-16,18-21,24H2,1H3,(H,36,38)(H,37,41)/b13-8+ |
| InChIKey | BKDOTQYPGBIDSO-MDWZMJQESA-N |
| XLogP | 5.86 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|