C29H37N5O — CID 160614517
5-piperidin-1-yl-1-[4-[4-(piperidin-4-ylamino)-1,6-naphthyridin-2-yl]phenyl]pentan-1-one (PubChem CID 160614517) has the molecular formula C29H37N5O and a molecular weight of 471.65 g/mol. Its IUPAC name is 5-piperidin-1-yl-1-[4-[4-(piperidin-4-ylamino)-1,6-naphthyridin-2-yl]phenyl]pentan-1-one.
| Compound Name | 5-piperidin-1-yl-1-[4-[4-(piperidin-4-ylamino)-1,6-naphthyridin-2-yl]phenyl]pentan-1-one |
|---|---|
| PubChem CID | 160614517 |
| Molecular Formula | C29H37N5O |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | 5-piperidin-1-yl-1-[4-[4-(piperidin-4-ylamino)-1,6-naphthyridin-2-yl]phenyl]pentan-1-one |
| SMILES | O=C(CCCCN1CCCCC1)c1ccc(-c2cc(NC3CCNCC3)c3cnccc3n2)cc1 |
| InChI | InChI=1S/C29H37N5O/c35-29(6-2-5-19-34-17-3-1-4-18-34)23-9-7-22(8-10-23)27-20-28(32-24-11-14-30-15-12-24)25-21-31-16-13-26(25)33-27/h7-10,13,16,20-21,24,30H,1-6,11-12,14-15,17-19H2,(H,32,33) |
| InChIKey | PWBLLEAYUMUFTC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|