C21H21ClN4O — CID 135372458
4-(4-chloro-1,6-naphthyridin-2-yl)-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 135372458) has the molecular formula C21H21ClN4O and a molecular weight of 380.88 g/mol. Its IUPAC name is 4-(4-chloro-1,6-naphthyridin-2-yl)-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 4-(4-chloro-1,6-naphthyridin-2-yl)-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 135372458 |
| Molecular Formula | C21H21ClN4O |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 4-(4-chloro-1,6-naphthyridin-2-yl)-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CN1CCC(NC(=O)c2ccc(-c3cc(Cl)c4cnccc4n3)cc2)CC1 |
| InChI | InChI=1S/C21H21ClN4O/c1-26-10-7-16(8-11-26)24-21(27)15-4-2-14(3-5-15)20-12-18(22)17-13-23-9-6-19(17)25-20/h2-6,9,12-13,16H,7-8,10-11H2,1H3,(H,24,27) |
| InChIKey | CIJPILWXBHSKRY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |