C15H24N2O — CID 142009687
ethane;N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 142009687) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is ethane;N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | ethane;N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 142009687 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | ethane;N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CC.CN1CCC(NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C13H18N2O.C2H6/c1-15-9-7-12(8-10-15)14-13(16)11-5-3-2-4-6-11;1-2/h2-6,12H,7-10H2,1H3,(H,14,16);1-2H3 |
| InChIKey | ZLTOOBCPNGQKMH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |