C13H19BN2O3 — CID 140843225
[4-[(1-methylpiperidin-4-yl)carbamoyl]phenyl]boronic acid (PubChem CID 140843225) has the molecular formula C13H19BN2O3 and a molecular weight of 262.12 g/mol. Its IUPAC name is [4-[(1-methylpiperidin-4-yl)carbamoyl]phenyl]boronic acid.
| Compound Name | [4-[(1-methylpiperidin-4-yl)carbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 140843225 |
| Molecular Formula | C13H19BN2O3 |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | [4-[(1-methylpiperidin-4-yl)carbamoyl]phenyl]boronic acid |
| SMILES | CN1CCC(NC(=O)c2ccc(B(O)O)cc2)CC1 |
| InChI | InChI=1S/C13H19BN2O3/c1-16-8-6-12(7-9-16)15-13(17)10-2-4-11(5-3-10)14(18)19/h2-5,12,18-19H,6-9H2,1H3,(H,15,17) |
| InChIKey | QKOCJDNVRYHCHX-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|