C14H24N2OS — CID 145257142
ethane;5-methyl-N-(1-methylpiperidin-4-yl)thiophene-3-carboxamide (PubChem CID 145257142) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is ethane;5-methyl-N-(1-methylpiperidin-4-yl)thiophene-3-carboxamide.
| Compound Name | ethane;5-methyl-N-(1-methylpiperidin-4-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 145257142 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | ethane;5-methyl-N-(1-methylpiperidin-4-yl)thiophene-3-carboxamide |
| SMILES | CC.Cc1cc(C(=O)NC2CCN(C)CC2)cs1 |
| InChI | InChI=1S/C12H18N2OS.C2H6/c1-9-7-10(8-16-9)12(15)13-11-3-5-14(2)6-4-11;1-2/h7-8,11H,3-6H2,1-2H3,(H,13,15);1-2H3 |
| InChIKey | LYCDQIHTBUNFLR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |