C32H36N4O — CID 44534688
(E)-N-(1-benzylpiperidin-4-yl)-3-[4-(6-tert-butyl-1H-benzimidazol-2-yl)phenyl]prop-2-enamide (PubChem CID 44534688) has the molecular formula C32H36N4O and a molecular weight of 492.67 g/mol. Its IUPAC name is (E)-N-(1-benzylpiperidin-4-yl)-3-[4-(6-tert-butyl-1H-benzimidazol-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1-benzylpiperidin-4-yl)-3-[4-(6-tert-butyl-1H-benzimidazol-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 44534688 |
| Molecular Formula | C32H36N4O |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | (E)-N-(1-benzylpiperidin-4-yl)-3-[4-(6-tert-butyl-1H-benzimidazol-2-yl)phenyl]prop-2-enamide |
| SMILES | CC(C)(C)c1ccc2nc(-c3ccc(/C=C/C(=O)NC4CCN(Cc5ccccc5)CC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C32H36N4O/c1-32(2,3)26-14-15-28-29(21-26)35-31(34-28)25-12-9-23(10-13-25)11-16-30(37)33-27-17-19-36(20-18-27)22-24-7-5-4-6-8-24/h4-16,21,27H,17-20,22H2,1-3H3,(H,33,37)(H,34,35)/b16-11+ |
| InChIKey | TWTCHQSSUPFFBT-LFIBNONCSA-N |
| XLogP | 6.32 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|