C30H32N4O — CID 44534666
(E)-N-(1-benzylpiperidin-4-yl)-3-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]prop-2-enamide (PubChem CID 44534666) has the molecular formula C30H32N4O and a molecular weight of 464.61 g/mol. Its IUPAC name is (E)-N-(1-benzylpiperidin-4-yl)-3-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1-benzylpiperidin-4-yl)-3-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 44534666 |
| Molecular Formula | C30H32N4O |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | (E)-N-(1-benzylpiperidin-4-yl)-3-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]prop-2-enamide |
| SMILES | Cc1cc2nc(-c3ccc(/C=C/C(=O)NC4CCN(Cc5ccccc5)CC4)cc3)[nH]c2cc1C |
| InChI | InChI=1S/C30H32N4O/c1-21-18-27-28(19-22(21)2)33-30(32-27)25-11-8-23(9-12-25)10-13-29(35)31-26-14-16-34(17-15-26)20-24-6-4-3-5-7-24/h3-13,18-19,26H,14-17,20H2,1-2H3,(H,31,35)(H,32,33)/b13-10+ |
| InChIKey | FPOURSOAOPHXCM-JLHYYAGUSA-N |
| XLogP | 5.64 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|