C30H28N6O — CID 177349687
N-[1-[[4-(6-phenyl-8H-imidazo[4,5-g]quinoxalin-7-yl)phenyl]methyl]piperidin-4-yl]prop-2-enamide (PubChem CID 177349687) has the molecular formula C30H28N6O and a molecular weight of 488.60 g/mol. Its IUPAC name is N-[1-[[4-(6-phenyl-8H-imidazo[4,5-g]quinoxalin-7-yl)phenyl]methyl]piperidin-4-yl]prop-2-enamide.
| Compound Name | N-[1-[[4-(6-phenyl-8H-imidazo[4,5-g]quinoxalin-7-yl)phenyl]methyl]piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 177349687 |
| Molecular Formula | C30H28N6O |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-[1-[[4-(6-phenyl-8H-imidazo[4,5-g]quinoxalin-7-yl)phenyl]methyl]piperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCN(Cc2ccc(-c3[nH]c4cc5ncnc5cc4nc3-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C30H28N6O/c1-2-28(37)33-23-12-14-36(15-13-23)18-20-8-10-22(11-9-20)30-29(21-6-4-3-5-7-21)34-26-16-24-25(32-19-31-24)17-27(26)35-30/h2-11,16-17,19,23,35H,1,12-15,18H2,(H,33,37) |
| InChIKey | UITXHNULEPGWLX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|