C16H19F3N2O3S — CID 155344254
N-[1-[[4-(trifluoromethylsulfonyl)phenyl]methyl]piperidin-4-yl]prop-2-enamide (PubChem CID 155344254) has the molecular formula C16H19F3N2O3S and a molecular weight of 376.40 g/mol. Its IUPAC name is N-[1-[[4-(trifluoromethylsulfonyl)phenyl]methyl]piperidin-4-yl]prop-2-enamide.
| Compound Name | N-[1-[[4-(trifluoromethylsulfonyl)phenyl]methyl]piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 155344254 |
| Molecular Formula | C16H19F3N2O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-[1-[[4-(trifluoromethylsulfonyl)phenyl]methyl]piperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCN(Cc2ccc(S(=O)(=O)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H19F3N2O3S/c1-2-15(22)20-13-7-9-21(10-8-13)11-12-3-5-14(6-4-12)25(23,24)16(17,18)19/h2-6,13H,1,7-11H2,(H,20,22) |
| InChIKey | NZPPYTQAEHMOKX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|