C18H22F3N3O2 — CID 155353601
N-methyl-4-(prop-2-enoylamino)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide (PubChem CID 155353601) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is N-methyl-4-(prop-2-enoylamino)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide.
| Compound Name | N-methyl-4-(prop-2-enoylamino)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 155353601 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-methyl-4-(prop-2-enoylamino)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide |
| SMILES | C=CC(=O)NC1CCN(Cc2ccc(C(F)(F)F)cc2)C(C(=O)NC)C1 |
| InChI | InChI=1S/C18H22F3N3O2/c1-3-16(25)23-14-8-9-24(15(10-14)17(26)22-2)11-12-4-6-13(7-5-12)18(19,20)21/h3-7,14-15H,1,8-11H2,2H3,(H,22,26)(H,23,25) |
| InChIKey | JHLGOZWRHWMCQA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|