C18H21F3N2O — CID 155344442
1-[(3aR,7aR)-1-[[4-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]prop-2-en-1-one (PubChem CID 155344442) has the molecular formula C18H21F3N2O and a molecular weight of 338.37 g/mol. Its IUPAC name is 1-[(3aR,7aR)-1-[[4-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]prop-2-en-1-one.
| Compound Name | 1-[(3aR,7aR)-1-[[4-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155344442 |
| Molecular Formula | C18H21F3N2O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[(3aR,7aR)-1-[[4-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@H]2CCN(Cc3ccc(C(F)(F)F)cc3)[C@H]2C1 |
| InChI | InChI=1S/C18H21F3N2O/c1-2-17(24)23-10-8-14-7-9-22(16(14)12-23)11-13-3-5-15(6-4-13)18(19,20)21/h2-6,14,16H,1,7-12H2/t14-,16+/m1/s1 |
| InChIKey | KDYRBFOVBNJFRJ-ZBFHGGJFSA-N |
| XLogP | 3.31 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|