C15H19F3N2O — CID 155732722
1-pyrrolidin-1-ylprop-2-en-1-one;[4-(trifluoromethyl)phenyl]methanamine (PubChem CID 155732722) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is 1-pyrrolidin-1-ylprop-2-en-1-one;[4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | 1-pyrrolidin-1-ylprop-2-en-1-one;[4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 155732722 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-pyrrolidin-1-ylprop-2-en-1-one;[4-(trifluoromethyl)phenyl]methanamine |
| SMILES | C=CC(=O)N1CCCC1.NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H8F3N.C7H11NO/c9-8(10,11)7-3-1-6(5-12)2-4-7;1-2-7(9)8-5-3-4-6-8/h1-4H,5,12H2;2H,1,3-6H2 |
| InChIKey | NFMMVIYQZPCIIJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|