C16H21F3N2O — CID 164596008
N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 164596008) has the molecular formula C16H21F3N2O and a molecular weight of 314.35 g/mol. Its IUPAC name is N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine;1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine;1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 164596008 |
| Molecular Formula | C16H21F3N2O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1.CNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H10F3N.C7H11NO/c1-13-6-7-3-2-4-8(5-7)9(10,11)12;1-2-7(9)8-5-3-4-6-8/h2-5,13H,6H2,1H3;2H,1,3-6H2 |
| InChIKey | QBBRJZGNGNGRMS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|