C9H12F3N — CID 145483676
N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine;molecular hydrogen (PubChem CID 145483676) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine;molecular hydrogen.
| Compound Name | N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine;molecular hydrogen |
|---|---|
| PubChem CID | 145483676 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine;molecular hydrogen |
| SMILES | CNCc1cccc(C(F)(F)F)c1.[H][H] |
| InChI | InChI=1S/C9H10F3N.H2/c1-13-6-7-3-2-4-8(5-7)9(10,11)12;/h2-5,13H,6H2,1H3;1H |
| InChIKey | YLQLSAIBRDULNV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |