C12H13F3N2 — CID 43242659
2-methyl-3-[[3-(trifluoromethyl)phenyl]methylamino]propanenitrile (PubChem CID 43242659) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-methyl-3-[[3-(trifluoromethyl)phenyl]methylamino]propanenitrile.
| Compound Name | 2-methyl-3-[[3-(trifluoromethyl)phenyl]methylamino]propanenitrile |
|---|---|
| PubChem CID | 43242659 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 2-methyl-3-[[3-(trifluoromethyl)phenyl]methylamino]propanenitrile |
| SMILES | CC(C#N)CNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2/c1-9(6-16)7-17-8-10-3-2-4-11(5-10)12(13,14)15/h2-5,9,17H,7-8H2,1H3 |
| InChIKey | MDBXDPCIGXKSKS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |