C16H19F3N2O2 — CID 134061591
1-(4-acetyl-1,4-diazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 134061591) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is 1-(4-acetyl-1,4-diazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-(4-acetyl-1,4-diazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 134061591 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-(4-acetyl-1,4-diazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | CC(=O)N1CCCN(C(=O)Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H19F3N2O2/c1-12(22)20-6-3-7-21(9-8-20)15(23)11-13-4-2-5-14(10-13)16(17,18)19/h2,4-5,10H,3,6-9,11H2,1H3 |
| InChIKey | AYGSGZRVHSEYMO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |