C16H17F3N6O2 — CID 78905090
1-[4-[2-(tetrazol-1-yl)acetyl]piperazin-1-yl]-2-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 78905090) has the molecular formula C16H17F3N6O2 and a molecular weight of 382.35 g/mol. Its IUPAC name is 1-[4-[2-(tetrazol-1-yl)acetyl]piperazin-1-yl]-2-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[4-[2-(tetrazol-1-yl)acetyl]piperazin-1-yl]-2-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 78905090 |
| Molecular Formula | C16H17F3N6O2 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-[4-[2-(tetrazol-1-yl)acetyl]piperazin-1-yl]-2-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)N1CCN(C(=O)Cn2cnnn2)CC1 |
| InChI | InChI=1S/C16H17F3N6O2/c17-16(18,19)13-3-1-2-12(8-13)9-14(26)23-4-6-24(7-5-23)15(27)10-25-11-20-21-22-25/h1-3,8,11H,4-7,9-10H2 |
| InChIKey | JXXCFHPCTVSXLJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |